C22H27Cl2N3O2 — CID 119756085
7-amino-N-[4-[(6-chloro-2-oxo-3H-indol-1-yl)methyl]phenyl]heptanamide;hydrochloride (PubChem CID 119756085) has the molecular formula C22H27Cl2N3O2 and a molecular weight of 436.38 g/mol. Its IUPAC name is 7-amino-N-[4-[(6-chloro-2-oxo-3H-indol-1-yl)methyl]phenyl]heptanamide;hydrochloride.
| Compound Name | 7-amino-N-[4-[(6-chloro-2-oxo-3H-indol-1-yl)methyl]phenyl]heptanamide;hydrochloride |
|---|---|
| PubChem CID | 119756085 |
| Molecular Formula | C22H27Cl2N3O2 |
| Molecular Weight | 436.38 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 7-amino-N-[4-[(6-chloro-2-oxo-3H-indol-1-yl)methyl]phenyl]heptanamide;hydrochloride |
| SMILES | Cl.NCCCCCCC(=O)Nc1ccc(CN2C(=O)Cc3ccc(Cl)cc32)cc1 |
| InChI | InChI=1S/C22H26ClN3O2.ClH/c23-18-9-8-17-13-22(28)26(20(17)14-18)15-16-6-10-19(11-7-16)25-21(27)5-3-1-2-4-12-24;/h6-11,14H,1-5,12-13,15,24H2,(H,25,27);1H |
| InChIKey | ZXEDVSMMDUZMLF-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.38 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|