C20H15F3N2O3S — CID 56508153
(E)-N-[4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]phenyl]-4,4,4-trifluoro-3-phenylbut-2-enamide (PubChem CID 56508153) has the molecular formula C20H15F3N2O3S and a molecular weight of 420.41 g/mol. Its IUPAC name is (E)-N-[4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]phenyl]-4,4,4-trifluoro-3-phenylbut-2-enamide.
| Compound Name | (E)-N-[4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]phenyl]-4,4,4-trifluoro-3-phenylbut-2-enamide |
|---|---|
| PubChem CID | 56508153 |
| Molecular Formula | C20H15F3N2O3S |
| Molecular Weight | 420.41 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | (E)-N-[4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]phenyl]-4,4,4-trifluoro-3-phenylbut-2-enamide |
| SMILES | O=C(/C=C(\c1ccccc1)C(F)(F)F)Nc1ccc(CN2C(=O)CSC2=O)cc1 |
| InChI | InChI=1S/C20H15F3N2O3S/c21-20(22,23)16(14-4-2-1-3-5-14)10-17(26)24-15-8-6-13(7-9-15)11-25-18(27)12-29-19(25)28/h1-10H,11-12H2,(H,24,26)/b16-10+ |
| InChIKey | UUKSHYUJAKCSHX-MHWRWJLKSA-N |
| XLogP | 4.47 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.41 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|