C19H17Cl2N3O3S — CID 56566577
1-[1-(3,4-dichlorophenyl)ethyl]-3-[4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]phenyl]urea (PubChem CID 56566577) has the molecular formula C19H17Cl2N3O3S and a molecular weight of 438.34 g/mol. Its IUPAC name is 1-[1-(3,4-dichlorophenyl)ethyl]-3-[4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]phenyl]urea.
| Compound Name | 1-[1-(3,4-dichlorophenyl)ethyl]-3-[4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]phenyl]urea |
|---|---|
| PubChem CID | 56566577 |
| Molecular Formula | C19H17Cl2N3O3S |
| Molecular Weight | 438.34 g/mol |
| Exact Mass | 437.04 |
| IUPAC Name | 1-[1-(3,4-dichlorophenyl)ethyl]-3-[4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]phenyl]urea |
| SMILES | CC(NC(=O)Nc1ccc(CN2C(=O)CSC2=O)cc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H17Cl2N3O3S/c1-11(13-4-7-15(20)16(21)8-13)22-18(26)23-14-5-2-12(3-6-14)9-24-17(25)10-28-19(24)27/h2-8,11H,9-10H2,1H3,(H2,22,23,26) |
| InChIKey | WCVZEQHXXVJLGB-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.34 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|