C17H17ClF2N2O2 — CID 51944888
1-[(1S)-1-(4-chlorophenyl)ethyl]-3-[4-(difluoromethoxy)phenyl]-1-methylurea (PubChem CID 51944888) has the molecular formula C17H17ClF2N2O2 and a molecular weight of 354.78 g/mol. Its IUPAC name is 1-[(1S)-1-(4-chlorophenyl)ethyl]-3-[4-(difluoromethoxy)phenyl]-1-methylurea.
| Compound Name | 1-[(1S)-1-(4-chlorophenyl)ethyl]-3-[4-(difluoromethoxy)phenyl]-1-methylurea |
|---|---|
| PubChem CID | 51944888 |
| Molecular Formula | C17H17ClF2N2O2 |
| Molecular Weight | 354.78 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 1-[(1S)-1-(4-chlorophenyl)ethyl]-3-[4-(difluoromethoxy)phenyl]-1-methylurea |
| SMILES | C[C@@H](c1ccc(Cl)cc1)N(C)C(=O)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C17H17ClF2N2O2/c1-11(12-3-5-13(18)6-4-12)22(2)17(23)21-14-7-9-15(10-8-14)24-16(19)20/h3-11,16H,1-2H3,(H,21,23)/t11-/m0/s1 |
| InChIKey | WVKXSHXVYCOAIZ-NSHDSACASA-N |
| XLogP | 5.17 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.78 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |