C13H13ClN4O — CID 61114600
2-amino-5-chloro-N,N-bis(2-cyanoethyl)benzamide (PubChem CID 61114600) has the molecular formula C13H13ClN4O and a molecular weight of 276.73 g/mol. Its IUPAC name is 2-amino-5-chloro-N,N-bis(2-cyanoethyl)benzamide.
| Compound Name | 2-amino-5-chloro-N,N-bis(2-cyanoethyl)benzamide |
|---|---|
| PubChem CID | 61114600 |
| Molecular Formula | C13H13ClN4O |
| Molecular Weight | 276.73 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 2-amino-5-chloro-N,N-bis(2-cyanoethyl)benzamide |
| SMILES | N#CCCN(CCC#N)C(=O)c1cc(Cl)ccc1N |
| InChI | InChI=1S/C13H13ClN4O/c14-10-3-4-12(17)11(9-10)13(19)18(7-1-5-15)8-2-6-16/h3-4,9H,1-2,7-8,17H2 |
| InChIKey | SNNSSONRPFEGCN-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 93.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.73 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|