C13H11BrClN3O — CID 113362626
3-bromo-2-chloro-N,N-bis(2-cyanoethyl)benzamide (PubChem CID 113362626) has the molecular formula C13H11BrClN3O and a molecular weight of 340.61 g/mol. Its IUPAC name is 3-bromo-2-chloro-N,N-bis(2-cyanoethyl)benzamide.
| Compound Name | 3-bromo-2-chloro-N,N-bis(2-cyanoethyl)benzamide |
|---|---|
| PubChem CID | 113362626 |
| Molecular Formula | C13H11BrClN3O |
| Molecular Weight | 340.61 g/mol |
| Exact Mass | 338.98 |
| IUPAC Name | 3-bromo-2-chloro-N,N-bis(2-cyanoethyl)benzamide |
| SMILES | N#CCCN(CCC#N)C(=O)c1cccc(Br)c1Cl |
| InChI | InChI=1S/C13H11BrClN3O/c14-11-5-1-4-10(12(11)15)13(19)18(8-2-6-16)9-3-7-17/h1,4-5H,2-3,8-9H2 |
| InChIKey | JNCWGWRLBPRCEA-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 67.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.61 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |