C12H11BrF5NO — CID 107491591
N-(2-bromoethyl)-N-(2,2-difluoroethyl)-3-(trifluoromethyl)benzamide (PubChem CID 107491591) has the molecular formula C12H11BrF5NO and a molecular weight of 360.12 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-(2,2-difluoroethyl)-3-(trifluoromethyl)benzamide.
| Compound Name | N-(2-bromoethyl)-N-(2,2-difluoroethyl)-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 107491591 |
| Molecular Formula | C12H11BrF5NO |
| Molecular Weight | 360.12 g/mol |
| Exact Mass | 358.99 |
| IUPAC Name | N-(2-bromoethyl)-N-(2,2-difluoroethyl)-3-(trifluoromethyl)benzamide |
| SMILES | O=C(c1cccc(C(F)(F)F)c1)N(CCBr)CC(F)F |
| InChI | InChI=1S/C12H11BrF5NO/c13-4-5-19(7-10(14)15)11(20)8-2-1-3-9(6-8)12(16,17)18/h1-3,6,10H,4-5,7H2 |
| InChIKey | ZIIMIBHYBSBHDN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.12 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|