C13H15BrF3NO — CID 113469197
N-(3-bromopropyl)-N-ethyl-3-(trifluoromethyl)benzamide (PubChem CID 113469197) has the molecular formula C13H15BrF3NO and a molecular weight of 338.17 g/mol. Its IUPAC name is N-(3-bromopropyl)-N-ethyl-3-(trifluoromethyl)benzamide.
| Compound Name | N-(3-bromopropyl)-N-ethyl-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 113469197 |
| Molecular Formula | C13H15BrF3NO |
| Molecular Weight | 338.17 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | N-(3-bromopropyl)-N-ethyl-3-(trifluoromethyl)benzamide |
| SMILES | CCN(CCCBr)C(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H15BrF3NO/c1-2-18(8-4-7-14)12(19)10-5-3-6-11(9-10)13(15,16)17/h3,5-6,9H,2,4,7-8H2,1H3 |
| InChIKey | WINAVXDXRXHJCD-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.17 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|