C16H23ClO2 — CID 117454745
3-(3-chloro-4-pentan-3-ylphenyl)-2,2-dimethylpropanoic acid (PubChem CID 117454745) has the molecular formula C16H23ClO2 and a molecular weight of 282.81 g/mol. Its IUPAC name is 3-(3-chloro-4-pentan-3-ylphenyl)-2,2-dimethylpropanoic acid.
| Compound Name | 3-(3-chloro-4-pentan-3-ylphenyl)-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 117454745 |
| Molecular Formula | C16H23ClO2 |
| Molecular Weight | 282.81 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 3-(3-chloro-4-pentan-3-ylphenyl)-2,2-dimethylpropanoic acid |
| SMILES | CCC(CC)c1ccc(CC(C)(C)C(=O)O)cc1Cl |
| InChI | InChI=1S/C16H23ClO2/c1-5-12(6-2)13-8-7-11(9-14(13)17)10-16(3,4)15(18)19/h7-9,12H,5-6,10H2,1-4H3,(H,18,19) |
| InChIKey | IGIHKYRXWZSZPH-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.81 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |