C16H21ClO2S — CID 117497938
3-[3-chloro-4-(thian-4-yl)phenyl]-2,2-dimethylpropanoic acid (PubChem CID 117497938) has the molecular formula C16H21ClO2S and a molecular weight of 312.86 g/mol. Its IUPAC name is 3-[3-chloro-4-(thian-4-yl)phenyl]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[3-chloro-4-(thian-4-yl)phenyl]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 117497938 |
| Molecular Formula | C16H21ClO2S |
| Molecular Weight | 312.86 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 3-[3-chloro-4-(thian-4-yl)phenyl]-2,2-dimethylpropanoic acid |
| SMILES | CC(C)(Cc1ccc(C2CCSCC2)c(Cl)c1)C(=O)O |
| InChI | InChI=1S/C16H21ClO2S/c1-16(2,15(18)19)10-11-3-4-13(14(17)9-11)12-5-7-20-8-6-12/h3-4,9,12H,5-8,10H2,1-2H3,(H,18,19) |
| InChIKey | PVFIFEFPFLDBSK-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.86 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |