C15H20O2 — CID 117336660
3-(4-cyclobutylphenyl)-2,2-dimethylpropanoic acid (PubChem CID 117336660) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is 3-(4-cyclobutylphenyl)-2,2-dimethylpropanoic acid.
| Compound Name | 3-(4-cyclobutylphenyl)-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 117336660 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | 3-(4-cyclobutylphenyl)-2,2-dimethylpropanoic acid |
| SMILES | CC(C)(Cc1ccc(C2CCC2)cc1)C(=O)O |
| InChI | InChI=1S/C15H20O2/c1-15(2,14(16)17)10-11-6-8-13(9-7-11)12-4-3-5-12/h6-9,12H,3-5,10H2,1-2H3,(H,16,17) |
| InChIKey | VUOZCAFGTQVSIK-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |