C14H16ClNO2 — CID 117418492
3-(3-chloro-1-methylindol-6-yl)-2,2-dimethylpropanoic acid (PubChem CID 117418492) has the molecular formula C14H16ClNO2 and a molecular weight of 265.74 g/mol. Its IUPAC name is 3-(3-chloro-1-methylindol-6-yl)-2,2-dimethylpropanoic acid.
| Compound Name | 3-(3-chloro-1-methylindol-6-yl)-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 117418492 |
| Molecular Formula | C14H16ClNO2 |
| Molecular Weight | 265.74 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 3-(3-chloro-1-methylindol-6-yl)-2,2-dimethylpropanoic acid |
| SMILES | Cn1cc(Cl)c2ccc(CC(C)(C)C(=O)O)cc21 |
| InChI | InChI=1S/C14H16ClNO2/c1-14(2,13(17)18)7-9-4-5-10-11(15)8-16(3)12(10)6-9/h4-6,8H,7H2,1-3H3,(H,17,18) |
| InChIKey | YOQLHSQODWTKSU-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.74 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |