C13H15BrO4 — CID 134656961
2-[2-(3-bromo-2-oxopropyl)-4-ethylphenyl]-2-hydroxyacetic acid (PubChem CID 134656961) has the molecular formula C13H15BrO4 and a molecular weight of 315.16 g/mol. Its IUPAC name is 2-[2-(3-bromo-2-oxopropyl)-4-ethylphenyl]-2-hydroxyacetic acid.
| Compound Name | 2-[2-(3-bromo-2-oxopropyl)-4-ethylphenyl]-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 134656961 |
| Molecular Formula | C13H15BrO4 |
| Molecular Weight | 315.16 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | 2-[2-(3-bromo-2-oxopropyl)-4-ethylphenyl]-2-hydroxyacetic acid |
| SMILES | CCc1ccc(C(O)C(=O)O)c(CC(=O)CBr)c1 |
| InChI | InChI=1S/C13H15BrO4/c1-2-8-3-4-11(12(16)13(17)18)9(5-8)6-10(15)7-14/h3-5,12,16H,2,6-7H2,1H3,(H,17,18) |
| InChIKey | DYXQJUMINSCXIZ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.16 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|