C14H15BrO6 — CID 134640741
2-[2-(3-bromo-2-oxopropyl)-4-ethoxycarbonylphenyl]-2-hydroxyacetic acid (PubChem CID 134640741) has the molecular formula C14H15BrO6 and a molecular weight of 359.17 g/mol. Its IUPAC name is 2-[2-(3-bromo-2-oxopropyl)-4-ethoxycarbonylphenyl]-2-hydroxyacetic acid.
| Compound Name | 2-[2-(3-bromo-2-oxopropyl)-4-ethoxycarbonylphenyl]-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 134640741 |
| Molecular Formula | C14H15BrO6 |
| Molecular Weight | 359.17 g/mol |
| Exact Mass | 358.01 |
| IUPAC Name | 2-[2-(3-bromo-2-oxopropyl)-4-ethoxycarbonylphenyl]-2-hydroxyacetic acid |
| SMILES | CCOC(=O)c1ccc(C(O)C(=O)O)c(CC(=O)CBr)c1 |
| InChI | InChI=1S/C14H15BrO6/c1-2-21-14(20)8-3-4-11(12(17)13(18)19)9(5-8)6-10(16)7-15/h3-5,12,17H,2,6-7H2,1H3,(H,18,19) |
| InChIKey | YBJIPGQVAOHUGI-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.17 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|