C11H11F4NO2S — CID 114187851
2-fluoro-4-[[2-(trifluoromethylsulfanyl)ethylamino]methyl]benzoic acid (PubChem CID 114187851) has the molecular formula C11H11F4NO2S and a molecular weight of 297.27 g/mol. Its IUPAC name is 2-fluoro-4-[[2-(trifluoromethylsulfanyl)ethylamino]methyl]benzoic acid.
| Compound Name | 2-fluoro-4-[[2-(trifluoromethylsulfanyl)ethylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 114187851 |
| Molecular Formula | C11H11F4NO2S |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | 2-fluoro-4-[[2-(trifluoromethylsulfanyl)ethylamino]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CNCCSC(F)(F)F)cc1F |
| InChI | InChI=1S/C11H11F4NO2S/c12-9-5-7(1-2-8(9)10(17)18)6-16-3-4-19-11(13,14)15/h1-2,5,16H,3-4,6H2,(H,17,18) |
| InChIKey | ZNKSZXNCBMMBGS-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|