2-fluoro-4-[(3,3,3-trifluoropropylamino)methyl]benzoic acid

C11H11F4NO2 — CID 106700026

IUPAC2-fluoro-4-[(3,3,3-trifluoropropylamino)methyl]benzoic acid
SMILESO=C(O)c1ccc(CNCCC(F)(F)F)cc1F
InChIInChI=1S/C11H11F4NO2/c12-9-5-7(1-2-8(9)10(17)18)6-16-4-3-11(13,14)15/h1-2,5,16H,3-4,6H2,(H,17,18)
InChIKeyLBISXMFRAQRNIQ-UHFFFAOYSA-N
MW265.21 g/mol
LogP2.57
Rot. Bonds5

About 2-fluoro-4-[(3,3,3-trifluoropropylamino)methyl]benzoic acid

2-fluoro-4-[(3,3,3-trifluoropropylamino)methyl]benzoic acid (PubChem CID 106700026) has the molecular formula C11H11F4NO2 and a molecular weight of 265.21 g/mol. Its IUPAC name is 2-fluoro-4-[(3,3,3-trifluoropropylamino)methyl]benzoic acid.

Molecular Properties

Compound Name2-fluoro-4-[(3,3,3-trifluoropropylamino)methyl]benzoic acid
PubChem CID106700026
Molecular FormulaC11H11F4NO2
Molecular Weight265.21 g/mol
Exact Mass265.07
IUPAC Name2-fluoro-4-[(3,3,3-trifluoropropylamino)methyl]benzoic acid
SMILESO=C(O)c1ccc(CNCCC(F)(F)F)cc1F
InChIInChI=1S/C11H11F4NO2/c12-9-5-7(1-2-8(9)10(17)18)6-16-4-3-11(13,14)15/h1-2,5,16H,3-4,6H2,(H,17,18)
InChIKeyLBISXMFRAQRNIQ-UHFFFAOYSA-N
XLogP2.57
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500265.21
LogP ≤ 52.57
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-fluoro-4-[(3,3,3-trifluoropropylamino)methyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-fluoro-4-[(3,3,3-trifluoropropylamino)methyl]benzoic acid?
The IUPAC name of 2-fluoro-4-[(3,3,3-trifluoropropylamino)methyl]benzoic acid (CID 106700026) is 2-fluoro-4-[(3,3,3-trifluoropropylamino)methyl]benzoic acid.
What is the SMILES notation for 2-fluoro-4-[(3,3,3-trifluoropropylamino)methyl]benzoic acid?
The canonical SMILES for 2-fluoro-4-[(3,3,3-trifluoropropylamino)methyl]benzoic acid is O=C(O)c1ccc(CNCCC(F)(F)F)cc1F.
What is the InChIKey of 2-fluoro-4-[(3,3,3-trifluoropropylamino)methyl]benzoic acid?
The InChIKey is LBISXMFRAQRNIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11F4NO2/c12-9-5-7(1-2-8(9)10(17)18)6-16-4-3-11(13,14)15/h1-2,5,16H,3-4,6H2,(H,17,18).
What are the key properties of 2-fluoro-4-[(3,3,3-trifluoropropylamino)methyl]benzoic acid?
2-fluoro-4-[(3,3,3-trifluoropropylamino)methyl]benzoic acid has a molecular weight of 265.21 g/mol, XLogP of 2.57, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-4-[(3,3,3-trifluoropropylamino)methyl]benzoic acid is sourced from PubChem (CID 106700026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).