C14H16FNO2S — CID 114187833
methyl 2-fluoro-4-[(2-prop-2-ynylsulfanylethylamino)methyl]benzoate (PubChem CID 114187833) has the molecular formula C14H16FNO2S and a molecular weight of 281.35 g/mol. Its IUPAC name is methyl 2-fluoro-4-[(2-prop-2-ynylsulfanylethylamino)methyl]benzoate.
| Compound Name | methyl 2-fluoro-4-[(2-prop-2-ynylsulfanylethylamino)methyl]benzoate |
|---|---|
| PubChem CID | 114187833 |
| Molecular Formula | C14H16FNO2S |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | methyl 2-fluoro-4-[(2-prop-2-ynylsulfanylethylamino)methyl]benzoate |
| SMILES | C#CCSCCNCc1ccc(C(=O)OC)c(F)c1 |
| InChI | InChI=1S/C14H16FNO2S/c1-3-7-19-8-6-16-10-11-4-5-12(13(15)9-11)14(17)18-2/h1,4-5,9,16H,6-8,10H2,2H3 |
| InChIKey | SMIAKWRWBVQQTI-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|