C11H14FNO2S — CID 106698616
methyl 4-(2-aminoethylsulfanylmethyl)-2-fluorobenzoate (PubChem CID 106698616) has the molecular formula C11H14FNO2S and a molecular weight of 243.30 g/mol. Its IUPAC name is methyl 4-(2-aminoethylsulfanylmethyl)-2-fluorobenzoate.
| Compound Name | methyl 4-(2-aminoethylsulfanylmethyl)-2-fluorobenzoate |
|---|---|
| PubChem CID | 106698616 |
| Molecular Formula | C11H14FNO2S |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | methyl 4-(2-aminoethylsulfanylmethyl)-2-fluorobenzoate |
| SMILES | COC(=O)c1ccc(CSCCN)cc1F |
| InChI | InChI=1S/C11H14FNO2S/c1-15-11(14)9-3-2-8(6-10(9)12)7-16-5-4-13/h2-3,6H,4-5,7,13H2,1H3 |
| InChIKey | FTMCAAKERMBBJR-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|