C14H13FN2O2S — CID 106698636
methyl 4-[(6-amino-3-pyridinyl)sulfanylmethyl]-2-fluorobenzoate (PubChem CID 106698636) has the molecular formula C14H13FN2O2S and a molecular weight of 292.34 g/mol. Its IUPAC name is methyl 4-[(6-amino-3-pyridinyl)sulfanylmethyl]-2-fluorobenzoate.
| Compound Name | methyl 4-[(6-amino-3-pyridinyl)sulfanylmethyl]-2-fluorobenzoate |
|---|---|
| PubChem CID | 106698636 |
| Molecular Formula | C14H13FN2O2S |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | methyl 4-[(6-amino-3-pyridinyl)sulfanylmethyl]-2-fluorobenzoate |
| SMILES | COC(=O)c1ccc(CSc2ccc(N)nc2)cc1F |
| InChI | InChI=1S/C14H13FN2O2S/c1-19-14(18)11-4-2-9(6-12(11)15)8-20-10-3-5-13(16)17-7-10/h2-7H,8H2,1H3,(H2,16,17) |
| InChIKey | WPYFOZVIAJQHSV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |