2,3-difluoro-4-(3-propoxypropylamino)benzoic acid

C13H17F2NO3 — CID 82944096

IUPAC2,3-difluoro-4-(3-propoxypropylamino)benzoic acid
SMILESCCCOCCCNc1ccc(C(=O)O)c(F)c1F
InChIInChI=1S/C13H17F2NO3/c1-2-7-19-8-3-6-16-10-5-4-9(13(17)18)11(14)12(10)15/h4-5,16H,2-3,6-8H2,1H3,(H,17,18)
InChIKeyMULBAOZILKQHPA-UHFFFAOYSA-N
MW273.28 g/mol
LogP2.89
Rot. Bonds8

About 2,3-difluoro-4-(3-propoxypropylamino)benzoic acid

2,3-difluoro-4-(3-propoxypropylamino)benzoic acid (PubChem CID 82944096) has the molecular formula C13H17F2NO3 and a molecular weight of 273.28 g/mol. Its IUPAC name is 2,3-difluoro-4-(3-propoxypropylamino)benzoic acid.

Molecular Properties

Compound Name2,3-difluoro-4-(3-propoxypropylamino)benzoic acid
PubChem CID82944096
Molecular FormulaC13H17F2NO3
Molecular Weight273.28 g/mol
Exact Mass273.12
IUPAC Name2,3-difluoro-4-(3-propoxypropylamino)benzoic acid
SMILESCCCOCCCNc1ccc(C(=O)O)c(F)c1F
InChIInChI=1S/C13H17F2NO3/c1-2-7-19-8-3-6-16-10-5-4-9(13(17)18)11(14)12(10)15/h4-5,16H,2-3,6-8H2,1H3,(H,17,18)
InChIKeyMULBAOZILKQHPA-UHFFFAOYSA-N
XLogP2.89
TPSA58.56 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds8
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500273.28
LogP ≤ 52.89
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2,3-difluoro-4-(3-propoxypropylamino)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-difluoro-4-(3-propoxypropylamino)benzoic acid?
The IUPAC name of 2,3-difluoro-4-(3-propoxypropylamino)benzoic acid (CID 82944096) is 2,3-difluoro-4-(3-propoxypropylamino)benzoic acid.
What is the SMILES notation for 2,3-difluoro-4-(3-propoxypropylamino)benzoic acid?
The canonical SMILES for 2,3-difluoro-4-(3-propoxypropylamino)benzoic acid is CCCOCCCNc1ccc(C(=O)O)c(F)c1F.
What is the InChIKey of 2,3-difluoro-4-(3-propoxypropylamino)benzoic acid?
The InChIKey is MULBAOZILKQHPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17F2NO3/c1-2-7-19-8-3-6-16-10-5-4-9(13(17)18)11(14)12(10)15/h4-5,16H,2-3,6-8H2,1H3,(H,17,18).
What are the key properties of 2,3-difluoro-4-(3-propoxypropylamino)benzoic acid?
2,3-difluoro-4-(3-propoxypropylamino)benzoic acid has a molecular weight of 273.28 g/mol, XLogP of 2.89, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-difluoro-4-(3-propoxypropylamino)benzoic acid is sourced from PubChem (CID 82944096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).