C10H12N6S — CID 80512148
3-(2-pyrazol-1-ylethylamino)pyridazine-4-carbothioamide (PubChem CID 80512148) has the molecular formula C10H12N6S and a molecular weight of 248.32 g/mol. Its IUPAC name is 3-(2-pyrazol-1-ylethylamino)pyridazine-4-carbothioamide.
| Compound Name | 3-(2-pyrazol-1-ylethylamino)pyridazine-4-carbothioamide |
|---|---|
| PubChem CID | 80512148 |
| Molecular Formula | C10H12N6S |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 3-(2-pyrazol-1-ylethylamino)pyridazine-4-carbothioamide |
| SMILES | NC(=S)c1ccnnc1NCCn1cccn1 |
| InChI | InChI=1S/C10H12N6S/c11-9(17)8-2-4-13-15-10(8)12-5-7-16-6-1-3-14-16/h1-4,6H,5,7H2,(H2,11,17)(H,12,15) |
| InChIKey | LTFDEJQHHIOXCB-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|