C10H16IN3O — CID 66300059
6-ethyl-5-iodo-2-(2-methoxyethyl)-N-methylpyrimidin-4-amine (PubChem CID 66300059) has the molecular formula C10H16IN3O and a molecular weight of 321.16 g/mol. Its IUPAC name is 6-ethyl-5-iodo-2-(2-methoxyethyl)-N-methylpyrimidin-4-amine.
| Compound Name | 6-ethyl-5-iodo-2-(2-methoxyethyl)-N-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 66300059 |
| Molecular Formula | C10H16IN3O |
| Molecular Weight | 321.16 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | 6-ethyl-5-iodo-2-(2-methoxyethyl)-N-methylpyrimidin-4-amine |
| SMILES | CCc1nc(CCOC)nc(NC)c1I |
| InChI | InChI=1S/C10H16IN3O/c1-4-7-9(11)10(12-2)14-8(13-7)5-6-15-3/h4-6H2,1-3H3,(H,12,13,14) |
| InChIKey | MCFDUUZTCZIUQF-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.16 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|