C14H16IN3O — CID 66292297
5-iodo-2-(2-methoxyethyl)-N-methyl-6-phenylpyrimidin-4-amine (PubChem CID 66292297) has the molecular formula C14H16IN3O and a molecular weight of 369.21 g/mol. Its IUPAC name is 5-iodo-2-(2-methoxyethyl)-N-methyl-6-phenylpyrimidin-4-amine.
| Compound Name | 5-iodo-2-(2-methoxyethyl)-N-methyl-6-phenylpyrimidin-4-amine |
|---|---|
| PubChem CID | 66292297 |
| Molecular Formula | C14H16IN3O |
| Molecular Weight | 369.21 g/mol |
| Exact Mass | 369.03 |
| IUPAC Name | 5-iodo-2-(2-methoxyethyl)-N-methyl-6-phenylpyrimidin-4-amine |
| SMILES | CNc1nc(CCOC)nc(-c2ccccc2)c1I |
| InChI | InChI=1S/C14H16IN3O/c1-16-14-12(15)13(10-6-4-3-5-7-10)17-11(18-14)8-9-19-2/h3-7H,8-9H2,1-2H3,(H,16,17,18) |
| InChIKey | IZVWDRSILCMTKL-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.21 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|