C16H20IN3O — CID 116729288
2-(1-ethoxypropyl)-5-iodo-N-methyl-6-phenylpyrimidin-4-amine (PubChem CID 116729288) has the molecular formula C16H20IN3O and a molecular weight of 397.26 g/mol. Its IUPAC name is 2-(1-ethoxypropyl)-5-iodo-N-methyl-6-phenylpyrimidin-4-amine.
| Compound Name | 2-(1-ethoxypropyl)-5-iodo-N-methyl-6-phenylpyrimidin-4-amine |
|---|---|
| PubChem CID | 116729288 |
| Molecular Formula | C16H20IN3O |
| Molecular Weight | 397.26 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | 2-(1-ethoxypropyl)-5-iodo-N-methyl-6-phenylpyrimidin-4-amine |
| SMILES | CCOC(CC)c1nc(NC)c(I)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C16H20IN3O/c1-4-12(21-5-2)15-19-14(11-9-7-6-8-10-11)13(17)16(18-3)20-15/h6-10,12H,4-5H2,1-3H3,(H,18,19,20) |
| InChIKey | NPXXITFXRYCJOQ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.26 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|