C12H20IN3O2 — CID 116729749
2-(1-ethoxypropyl)-5-iodo-6-(methoxymethyl)-N-methylpyrimidin-4-amine (PubChem CID 116729749) has the molecular formula C12H20IN3O2 and a molecular weight of 365.22 g/mol. Its IUPAC name is 2-(1-ethoxypropyl)-5-iodo-6-(methoxymethyl)-N-methylpyrimidin-4-amine.
| Compound Name | 2-(1-ethoxypropyl)-5-iodo-6-(methoxymethyl)-N-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 116729749 |
| Molecular Formula | C12H20IN3O2 |
| Molecular Weight | 365.22 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | 2-(1-ethoxypropyl)-5-iodo-6-(methoxymethyl)-N-methylpyrimidin-4-amine |
| SMILES | CCOC(CC)c1nc(COC)c(I)c(NC)n1 |
| InChI | InChI=1S/C12H20IN3O2/c1-5-9(18-6-2)11-15-8(7-17-4)10(13)12(14-3)16-11/h9H,5-7H2,1-4H3,(H,14,15,16) |
| InChIKey | CVYYYCOAWPEOHH-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.22 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|