C15H18IN3 — CID 66304850
N-ethyl-5-iodo-6-phenyl-2-propan-2-ylpyrimidin-4-amine (PubChem CID 66304850) has the molecular formula C15H18IN3 and a molecular weight of 367.23 g/mol. Its IUPAC name is N-ethyl-5-iodo-6-phenyl-2-propan-2-ylpyrimidin-4-amine.
| Compound Name | N-ethyl-5-iodo-6-phenyl-2-propan-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 66304850 |
| Molecular Formula | C15H18IN3 |
| Molecular Weight | 367.23 g/mol |
| Exact Mass | 367.05 |
| IUPAC Name | N-ethyl-5-iodo-6-phenyl-2-propan-2-ylpyrimidin-4-amine |
| SMILES | CCNc1nc(C(C)C)nc(-c2ccccc2)c1I |
| InChI | InChI=1S/C15H18IN3/c1-4-17-15-12(16)13(11-8-6-5-7-9-11)18-14(19-15)10(2)3/h5-10H,4H2,1-3H3,(H,17,18,19) |
| InChIKey | JMYVVGPNYBLSQP-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.23 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|