C16H20IN3S — CID 66307036
N-ethyl-5-iodo-6-phenyl-2-(propylsulfanylmethyl)pyrimidin-4-amine (PubChem CID 66307036) has the molecular formula C16H20IN3S and a molecular weight of 413.33 g/mol. Its IUPAC name is N-ethyl-5-iodo-6-phenyl-2-(propylsulfanylmethyl)pyrimidin-4-amine.
| Compound Name | N-ethyl-5-iodo-6-phenyl-2-(propylsulfanylmethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 66307036 |
| Molecular Formula | C16H20IN3S |
| Molecular Weight | 413.33 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | N-ethyl-5-iodo-6-phenyl-2-(propylsulfanylmethyl)pyrimidin-4-amine |
| SMILES | CCCSCc1nc(NCC)c(I)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C16H20IN3S/c1-3-10-21-11-13-19-15(12-8-6-5-7-9-12)14(17)16(20-13)18-4-2/h5-9H,3-4,10-11H2,1-2H3,(H,18,19,20) |
| InChIKey | ZRSBXORJDJVYAA-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.33 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|