C13H19F2N3O — CID 103151390
2-[2-(2,2-difluoroethoxy)ethyl]-4-ethyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine (PubChem CID 103151390) has the molecular formula C13H19F2N3O and a molecular weight of 271.31 g/mol. Its IUPAC name is 2-[2-(2,2-difluoroethoxy)ethyl]-4-ethyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine.
| Compound Name | 2-[2-(2,2-difluoroethoxy)ethyl]-4-ethyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 103151390 |
| Molecular Formula | C13H19F2N3O |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | 2-[2-(2,2-difluoroethoxy)ethyl]-4-ethyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine |
| SMILES | CCc1nc(CCOCC(F)F)nc2c1CNCC2 |
| InChI | InChI=1S/C13H19F2N3O/c1-2-10-9-7-16-5-3-11(9)18-13(17-10)4-6-19-8-12(14)15/h12,16H,2-8H2,1H3 |
| InChIKey | WEMZYQQGFNRQFG-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|