C10H14F2N2OS — CID 103150663
2-[2-(2,2-difluoroethoxy)ethyl]-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine (PubChem CID 103150663) has the molecular formula C10H14F2N2OS and a molecular weight of 248.30 g/mol. Its IUPAC name is 2-[2-(2,2-difluoroethoxy)ethyl]-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine.
| Compound Name | 2-[2-(2,2-difluoroethoxy)ethyl]-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine |
|---|---|
| PubChem CID | 103150663 |
| Molecular Formula | C10H14F2N2OS |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 2-[2-(2,2-difluoroethoxy)ethyl]-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine |
| SMILES | FC(F)COCCc1nc2c(s1)CNCC2 |
| InChI | InChI=1S/C10H14F2N2OS/c11-9(12)6-15-4-2-10-14-7-1-3-13-5-8(7)16-10/h9,13H,1-6H2 |
| InChIKey | YQMFWNUJYHZBHI-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|