C17H22N2OS — CID 82154582
2-[3-(3,4-dimethylphenoxy)propyl]-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine (PubChem CID 82154582) has the molecular formula C17H22N2OS and a molecular weight of 302.44 g/mol. Its IUPAC name is 2-[3-(3,4-dimethylphenoxy)propyl]-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine.
| Compound Name | 2-[3-(3,4-dimethylphenoxy)propyl]-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine |
|---|---|
| PubChem CID | 82154582 |
| Molecular Formula | C17H22N2OS |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 2-[3-(3,4-dimethylphenoxy)propyl]-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine |
| SMILES | Cc1ccc(OCCCc2nc3c(s2)CNCC3)cc1C |
| InChI | InChI=1S/C17H22N2OS/c1-12-5-6-14(10-13(12)2)20-9-3-4-17-19-15-7-8-18-11-16(15)21-17/h5-6,10,18H,3-4,7-9,11H2,1-2H3 |
| InChIKey | MLZIHZWXYUCGCR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|