C10H15F2N3O2 — CID 103209298
3-(2,2-difluoroethoxy)-N-(5-ethyl-1H-pyrazol-3-yl)propanamide (PubChem CID 103209298) has the molecular formula C10H15F2N3O2 and a molecular weight of 247.24 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-N-(5-ethyl-1H-pyrazol-3-yl)propanamide.
| Compound Name | 3-(2,2-difluoroethoxy)-N-(5-ethyl-1H-pyrazol-3-yl)propanamide |
|---|---|
| PubChem CID | 103209298 |
| Molecular Formula | C10H15F2N3O2 |
| Molecular Weight | 247.24 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-N-(5-ethyl-1H-pyrazol-3-yl)propanamide |
| SMILES | CCc1cc(NC(=O)CCOCC(F)F)n[nH]1 |
| InChI | InChI=1S/C10H15F2N3O2/c1-2-7-5-9(15-14-7)13-10(16)3-4-17-6-8(11)12/h5,8H,2-4,6H2,1H3,(H2,13,14,15,16) |
| InChIKey | PCTSEKYFTGSVRE-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.24 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|