C12H17F2N3O3 — CID 124843258
3-(2,2-difluoroethoxy)-N-[5-[(2S)-oxolan-2-yl]-1H-pyrazol-3-yl]propanamide (PubChem CID 124843258) has the molecular formula C12H17F2N3O3 and a molecular weight of 289.28 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-N-[5-[(2S)-oxolan-2-yl]-1H-pyrazol-3-yl]propanamide.
| Compound Name | 3-(2,2-difluoroethoxy)-N-[5-[(2S)-oxolan-2-yl]-1H-pyrazol-3-yl]propanamide |
|---|---|
| PubChem CID | 124843258 |
| Molecular Formula | C12H17F2N3O3 |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-N-[5-[(2S)-oxolan-2-yl]-1H-pyrazol-3-yl]propanamide |
| SMILES | O=C(CCOCC(F)F)Nc1cc([C@@H]2CCCO2)[nH]n1 |
| InChI | InChI=1S/C12H17F2N3O3/c13-10(14)7-19-5-3-12(18)15-11-6-8(16-17-11)9-2-1-4-20-9/h6,9-10H,1-5,7H2,(H2,15,16,17,18)/t9-/m0/s1 |
| InChIKey | DLLURMAPCMMZKJ-VIFPVBQESA-N |
| XLogP | 1.87 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|