C10H18F2N2O2 — CID 103206351
3-(2,2-difluoroethoxy)-N-piperidin-3-ylpropanamide (PubChem CID 103206351) has the molecular formula C10H18F2N2O2 and a molecular weight of 236.26 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-N-piperidin-3-ylpropanamide.
| Compound Name | 3-(2,2-difluoroethoxy)-N-piperidin-3-ylpropanamide |
|---|---|
| PubChem CID | 103206351 |
| Molecular Formula | C10H18F2N2O2 |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-N-piperidin-3-ylpropanamide |
| SMILES | O=C(CCOCC(F)F)NC1CCCNC1 |
| InChI | InChI=1S/C10H18F2N2O2/c11-9(12)7-16-5-3-10(15)14-8-2-1-4-13-6-8/h8-9,13H,1-7H2,(H,14,15) |
| InChIKey | IMXKHNDEYHQDTL-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|