C11H19F3N2O2 — CID 105061008
N-(azepan-4-yl)-3-(2,2,2-trifluoroethoxy)propanamide (PubChem CID 105061008) has the molecular formula C11H19F3N2O2 and a molecular weight of 268.28 g/mol. Its IUPAC name is N-(azepan-4-yl)-3-(2,2,2-trifluoroethoxy)propanamide.
| Compound Name | N-(azepan-4-yl)-3-(2,2,2-trifluoroethoxy)propanamide |
|---|---|
| PubChem CID | 105061008 |
| Molecular Formula | C11H19F3N2O2 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | N-(azepan-4-yl)-3-(2,2,2-trifluoroethoxy)propanamide |
| SMILES | O=C(CCOCC(F)(F)F)NC1CCCNCC1 |
| InChI | InChI=1S/C11H19F3N2O2/c12-11(13,14)8-18-7-4-10(17)16-9-2-1-5-15-6-3-9/h9,15H,1-8H2,(H,16,17) |
| InChIKey | MVVSWTBFQLDCAH-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|