C13H23F3N2O2 — CID 103206325
N-[4-(ethylamino)cyclohexyl]-3-(2,2,2-trifluoroethoxy)propanamide (PubChem CID 103206325) has the molecular formula C13H23F3N2O2 and a molecular weight of 296.33 g/mol. Its IUPAC name is N-[4-(ethylamino)cyclohexyl]-3-(2,2,2-trifluoroethoxy)propanamide.
| Compound Name | N-[4-(ethylamino)cyclohexyl]-3-(2,2,2-trifluoroethoxy)propanamide |
|---|---|
| PubChem CID | 103206325 |
| Molecular Formula | C13H23F3N2O2 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | N-[4-(ethylamino)cyclohexyl]-3-(2,2,2-trifluoroethoxy)propanamide |
| SMILES | CCNC1CCC(NC(=O)CCOCC(F)(F)F)CC1 |
| InChI | InChI=1S/C13H23F3N2O2/c1-2-17-10-3-5-11(6-4-10)18-12(19)7-8-20-9-13(14,15)16/h10-11,17H,2-9H2,1H3,(H,18,19) |
| InChIKey | HITJQHLVEHLXTE-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|