C14H28N4 — CID 63109005
N-[[2-[2-(diethylamino)ethyl]-1H-imidazol-5-yl]methyl]-2-methylpropan-2-amine (PubChem CID 63109005) has the molecular formula C14H28N4 and a molecular weight of 252.41 g/mol. Its IUPAC name is N-[[2-[2-(diethylamino)ethyl]-1H-imidazol-5-yl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[2-[2-(diethylamino)ethyl]-1H-imidazol-5-yl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 63109005 |
| Molecular Formula | C14H28N4 |
| Molecular Weight | 252.41 g/mol |
| Exact Mass | 252.23 |
| IUPAC Name | N-[[2-[2-(diethylamino)ethyl]-1H-imidazol-5-yl]methyl]-2-methylpropan-2-amine |
| SMILES | CCN(CC)CCc1ncc(CNC(C)(C)C)[nH]1 |
| InChI | InChI=1S/C14H28N4/c1-6-18(7-2)9-8-13-15-10-12(17-13)11-16-14(3,4)5/h10,16H,6-9,11H2,1-5H3,(H,15,17) |
| InChIKey | GZWOGBZJALLLTQ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.41 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |