C10H19N3 — CID 63108587
N-[(2-propyl-1H-imidazol-5-yl)methyl]propan-1-amine (PubChem CID 63108587) has the molecular formula C10H19N3 and a molecular weight of 181.28 g/mol. Its IUPAC name is N-[(2-propyl-1H-imidazol-5-yl)methyl]propan-1-amine.
| Compound Name | N-[(2-propyl-1H-imidazol-5-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 63108587 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | N-[(2-propyl-1H-imidazol-5-yl)methyl]propan-1-amine |
| SMILES | CCCNCc1cnc(CCC)[nH]1 |
| InChI | InChI=1S/C10H19N3/c1-3-5-10-12-8-9(13-10)7-11-6-4-2/h8,11H,3-7H2,1-2H3,(H,12,13) |
| InChIKey | ARLLGSFWAUSRKW-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|