C10H19N3O — CID 63109492
2-methoxy-N-[(2-propyl-1H-imidazol-5-yl)methyl]ethanamine (PubChem CID 63109492) has the molecular formula C10H19N3O and a molecular weight of 197.28 g/mol. Its IUPAC name is 2-methoxy-N-[(2-propyl-1H-imidazol-5-yl)methyl]ethanamine.
| Compound Name | 2-methoxy-N-[(2-propyl-1H-imidazol-5-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 63109492 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | 2-methoxy-N-[(2-propyl-1H-imidazol-5-yl)methyl]ethanamine |
| SMILES | CCCc1ncc(CNCCOC)[nH]1 |
| InChI | InChI=1S/C10H19N3O/c1-3-4-10-12-8-9(13-10)7-11-5-6-14-2/h8,11H,3-7H2,1-2H3,(H,12,13) |
| InChIKey | DHVVFJYFQBSFJK-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|