C16H23N3O2 — CID 63109166
N-[[2-[(3,4-dimethoxyphenyl)methyl]-1H-imidazol-5-yl]methyl]propan-1-amine (PubChem CID 63109166) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is N-[[2-[(3,4-dimethoxyphenyl)methyl]-1H-imidazol-5-yl]methyl]propan-1-amine.
| Compound Name | N-[[2-[(3,4-dimethoxyphenyl)methyl]-1H-imidazol-5-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 63109166 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | N-[[2-[(3,4-dimethoxyphenyl)methyl]-1H-imidazol-5-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cnc(Cc2ccc(OC)c(OC)c2)[nH]1 |
| InChI | InChI=1S/C16H23N3O2/c1-4-7-17-10-13-11-18-16(19-13)9-12-5-6-14(20-2)15(8-12)21-3/h5-6,8,11,17H,4,7,9-10H2,1-3H3,(H,18,19) |
| InChIKey | CNDTZLGXQKFTLP-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 59.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|