C11H17N3O5S — CID 116699770
ethyl 5-[2-(3-methoxypropylamino)-2-oxoethyl]sulfanyl-1,3,4-oxadiazole-2-carboxylate (PubChem CID 116699770) has the molecular formula C11H17N3O5S and a molecular weight of 303.34 g/mol. Its IUPAC name is ethyl 5-[2-(3-methoxypropylamino)-2-oxoethyl]sulfanyl-1,3,4-oxadiazole-2-carboxylate.
| Compound Name | ethyl 5-[2-(3-methoxypropylamino)-2-oxoethyl]sulfanyl-1,3,4-oxadiazole-2-carboxylate |
|---|---|
| PubChem CID | 116699770 |
| Molecular Formula | C11H17N3O5S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | ethyl 5-[2-(3-methoxypropylamino)-2-oxoethyl]sulfanyl-1,3,4-oxadiazole-2-carboxylate |
| SMILES | CCOC(=O)c1nnc(SCC(=O)NCCCOC)o1 |
| InChI | InChI=1S/C11H17N3O5S/c1-3-18-10(16)9-13-14-11(19-9)20-7-8(15)12-5-4-6-17-2/h3-7H2,1-2H3,(H,12,15) |
| InChIKey | DJWQZVQNOOWTFX-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 103.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|