C13H22N4O4 — CID 103105166
ethyl 1-[1-(3-methoxypropylamino)-1-oxopropan-2-yl]-5-methyltriazole-4-carboxylate (PubChem CID 103105166) has the molecular formula C13H22N4O4 and a molecular weight of 298.34 g/mol. Its IUPAC name is ethyl 1-[1-(3-methoxypropylamino)-1-oxopropan-2-yl]-5-methyltriazole-4-carboxylate.
| Compound Name | ethyl 1-[1-(3-methoxypropylamino)-1-oxopropan-2-yl]-5-methyltriazole-4-carboxylate |
|---|---|
| PubChem CID | 103105166 |
| Molecular Formula | C13H22N4O4 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | ethyl 1-[1-(3-methoxypropylamino)-1-oxopropan-2-yl]-5-methyltriazole-4-carboxylate |
| SMILES | CCOC(=O)c1nnn(C(C)C(=O)NCCCOC)c1C |
| InChI | InChI=1S/C13H22N4O4/c1-5-21-13(19)11-9(2)17(16-15-11)10(3)12(18)14-7-6-8-20-4/h10H,5-8H2,1-4H3,(H,14,18) |
| InChIKey | MNQLKHLEEDCNRL-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|