C13H21ClN4O3 — CID 103109457
ethyl 1-[1-(butan-2-ylamino)-1-oxopropan-2-yl]-5-(chloromethyl)triazole-4-carboxylate (PubChem CID 103109457) has the molecular formula C13H21ClN4O3 and a molecular weight of 316.79 g/mol. Its IUPAC name is ethyl 1-[1-(butan-2-ylamino)-1-oxopropan-2-yl]-5-(chloromethyl)triazole-4-carboxylate.
| Compound Name | ethyl 1-[1-(butan-2-ylamino)-1-oxopropan-2-yl]-5-(chloromethyl)triazole-4-carboxylate |
|---|---|
| PubChem CID | 103109457 |
| Molecular Formula | C13H21ClN4O3 |
| Molecular Weight | 316.79 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | ethyl 1-[1-(butan-2-ylamino)-1-oxopropan-2-yl]-5-(chloromethyl)triazole-4-carboxylate |
| SMILES | CCOC(=O)c1nnn(C(C)C(=O)NC(C)CC)c1CCl |
| InChI | InChI=1S/C13H21ClN4O3/c1-5-8(3)15-12(19)9(4)18-10(7-14)11(16-17-18)13(20)21-6-2/h8-9H,5-7H2,1-4H3,(H,15,19) |
| InChIKey | KIFGMCSMZPJERE-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.79 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|