C14H24N4O3 — CID 103104945
ethyl 5-methyl-1-[1-(3-methylbutylamino)-1-oxopropan-2-yl]triazole-4-carboxylate (PubChem CID 103104945) has the molecular formula C14H24N4O3 and a molecular weight of 296.37 g/mol. Its IUPAC name is ethyl 5-methyl-1-[1-(3-methylbutylamino)-1-oxopropan-2-yl]triazole-4-carboxylate.
| Compound Name | ethyl 5-methyl-1-[1-(3-methylbutylamino)-1-oxopropan-2-yl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 103104945 |
| Molecular Formula | C14H24N4O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | ethyl 5-methyl-1-[1-(3-methylbutylamino)-1-oxopropan-2-yl]triazole-4-carboxylate |
| SMILES | CCOC(=O)c1nnn(C(C)C(=O)NCCC(C)C)c1C |
| InChI | InChI=1S/C14H24N4O3/c1-6-21-14(20)12-10(4)18(17-16-12)11(5)13(19)15-8-7-9(2)3/h9,11H,6-8H2,1-5H3,(H,15,19) |
| InChIKey | CJNGQPAYDPBBAR-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |