C12H19N5O4 — CID 103113096
2-methylpropyl 1-[1-(carbamoylamino)-1-oxopropan-2-yl]-5-methyltriazole-4-carboxylate (PubChem CID 103113096) has the molecular formula C12H19N5O4 and a molecular weight of 297.32 g/mol. Its IUPAC name is 2-methylpropyl 1-[1-(carbamoylamino)-1-oxopropan-2-yl]-5-methyltriazole-4-carboxylate.
| Compound Name | 2-methylpropyl 1-[1-(carbamoylamino)-1-oxopropan-2-yl]-5-methyltriazole-4-carboxylate |
|---|---|
| PubChem CID | 103113096 |
| Molecular Formula | C12H19N5O4 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 2-methylpropyl 1-[1-(carbamoylamino)-1-oxopropan-2-yl]-5-methyltriazole-4-carboxylate |
| SMILES | Cc1c(C(=O)OCC(C)C)nnn1C(C)C(=O)NC(N)=O |
| InChI | InChI=1S/C12H19N5O4/c1-6(2)5-21-11(19)9-7(3)17(16-15-9)8(4)10(18)14-12(13)20/h6,8H,5H2,1-4H3,(H3,13,14,18,20) |
| InChIKey | QPTHVACHZGHUHJ-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 129.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |