C22H25F2NO — CID 169240229
azepan-1-yl(cyclopropyl)methanone;1,3-difluoro-2-phenylbenzene (PubChem CID 169240229) has the molecular formula C22H25F2NO and a molecular weight of 357.44 g/mol. Its IUPAC name is azepan-1-yl(cyclopropyl)methanone;1,3-difluoro-2-phenylbenzene.
| Compound Name | azepan-1-yl(cyclopropyl)methanone;1,3-difluoro-2-phenylbenzene |
|---|---|
| PubChem CID | 169240229 |
| Molecular Formula | C22H25F2NO |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | azepan-1-yl(cyclopropyl)methanone;1,3-difluoro-2-phenylbenzene |
| SMILES | Fc1cccc(F)c1-c1ccccc1.O=C(C1CC1)N1CCCCCC1 |
| InChI | InChI=1S/C12H8F2.C10H17NO/c13-10-7-4-8-11(14)12(10)9-5-2-1-3-6-9;12-10(9-5-6-9)11-7-3-1-2-4-8-11/h1-8H;9H,1-8H2 |
| InChIKey | RVTFFVGYINFYTO-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |