C21H32FN3O3 — CID 7328579
2-[2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethoxy]-N-[(2R)-heptan-2-yl]acetamide (PubChem CID 7328579) has the molecular formula C21H32FN3O3 and a molecular weight of 393.50 g/mol. Its IUPAC name is 2-[2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethoxy]-N-[(2R)-heptan-2-yl]acetamide.
| Compound Name | 2-[2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethoxy]-N-[(2R)-heptan-2-yl]acetamide |
|---|---|
| PubChem CID | 7328579 |
| Molecular Formula | C21H32FN3O3 |
| Molecular Weight | 393.50 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | 2-[2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethoxy]-N-[(2R)-heptan-2-yl]acetamide |
| SMILES | CCCCC[C@@H](C)NC(=O)COCC(=O)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C21H32FN3O3/c1-3-4-5-8-17(2)23-20(26)15-28-16-21(27)25-13-11-24(12-14-25)19-10-7-6-9-18(19)22/h6-7,9-10,17H,3-5,8,11-16H2,1-2H3,(H,23,26)/t17-/m1/s1 |
| InChIKey | XFUAPFCRZPZMCN-QGZVFWFLSA-N |
| XLogP | 2.58 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.50 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|