C12H16ClN3O3S — CID 62505497
4-[2-(3-chlorophenyl)acetyl]piperazine-1-sulfonamide (PubChem CID 62505497) has the molecular formula C12H16ClN3O3S and a molecular weight of 317.80 g/mol. Its IUPAC name is 4-[2-(3-chlorophenyl)acetyl]piperazine-1-sulfonamide.
| Compound Name | 4-[2-(3-chlorophenyl)acetyl]piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 62505497 |
| Molecular Formula | C12H16ClN3O3S |
| Molecular Weight | 317.80 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 4-[2-(3-chlorophenyl)acetyl]piperazine-1-sulfonamide |
| SMILES | NS(=O)(=O)N1CCN(C(=O)Cc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C12H16ClN3O3S/c13-11-3-1-2-10(8-11)9-12(17)15-4-6-16(7-5-15)20(14,18)19/h1-3,8H,4-7,9H2,(H2,14,18,19) |
| InChIKey | JHWIFYKNSVMJOH-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.80 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |