C14H19ClN4O2 — CID 77011840
2-[4-[2-(3-chlorophenyl)acetyl]piperazin-1-yl]-N'-hydroxyethanimidamide (PubChem CID 77011840) has the molecular formula C14H19ClN4O2 and a molecular weight of 310.78 g/mol. Its IUPAC name is 2-[4-[2-(3-chlorophenyl)acetyl]piperazin-1-yl]-N'-hydroxyethanimidamide.
| Compound Name | 2-[4-[2-(3-chlorophenyl)acetyl]piperazin-1-yl]-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 77011840 |
| Molecular Formula | C14H19ClN4O2 |
| Molecular Weight | 310.78 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 2-[4-[2-(3-chlorophenyl)acetyl]piperazin-1-yl]-N'-hydroxyethanimidamide |
| SMILES | NC(CN1CCN(C(=O)Cc2cccc(Cl)c2)CC1)=NO |
| InChI | InChI=1S/C14H19ClN4O2/c15-12-3-1-2-11(8-12)9-14(20)19-6-4-18(5-7-19)10-13(16)17-21/h1-3,8,21H,4-7,9-10H2,(H2,16,17) |
| InChIKey | DZUWXULGAVCDQD-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 82.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.78 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|