C18H22Cl2N2O3S — CID 160916678
4-[2-[3-(3,4-dichlorophenyl)propylamino]ethoxy]-N-methylaniline;sulfur dioxide (PubChem CID 160916678) has the molecular formula C18H22Cl2N2O3S and a molecular weight of 417.36 g/mol. Its IUPAC name is 4-[2-[3-(3,4-dichlorophenyl)propylamino]ethoxy]-N-methylaniline;sulfur dioxide.
| Compound Name | 4-[2-[3-(3,4-dichlorophenyl)propylamino]ethoxy]-N-methylaniline;sulfur dioxide |
|---|---|
| PubChem CID | 160916678 |
| Molecular Formula | C18H22Cl2N2O3S |
| Molecular Weight | 417.36 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | 4-[2-[3-(3,4-dichlorophenyl)propylamino]ethoxy]-N-methylaniline;sulfur dioxide |
| SMILES | CNc1ccc(OCCNCCCc2ccc(Cl)c(Cl)c2)cc1.O=S=O |
| InChI | InChI=1S/C18H22Cl2N2O.O2S/c1-21-15-5-7-16(8-6-15)23-12-11-22-10-2-3-14-4-9-17(19)18(20)13-14;1-3-2/h4-9,13,21-22H,2-3,10-12H2,1H3; |
| InChIKey | SRMKOHWVMXTKHO-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.36 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|