C18H19ClN2O4S — CID 7827108
[2-oxo-2-[[(1R)-1-thiophen-2-ylethyl]amino]ethyl] 3-[(4-chlorobenzoyl)amino]propanoate (PubChem CID 7827108) has the molecular formula C18H19ClN2O4S and a molecular weight of 394.88 g/mol. Its IUPAC name is [2-oxo-2-[[(1R)-1-thiophen-2-ylethyl]amino]ethyl] 3-[(4-chlorobenzoyl)amino]propanoate.
| Compound Name | [2-oxo-2-[[(1R)-1-thiophen-2-ylethyl]amino]ethyl] 3-[(4-chlorobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 7827108 |
| Molecular Formula | C18H19ClN2O4S |
| Molecular Weight | 394.88 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | [2-oxo-2-[[(1R)-1-thiophen-2-ylethyl]amino]ethyl] 3-[(4-chlorobenzoyl)amino]propanoate |
| SMILES | C[C@@H](NC(=O)COC(=O)CCNC(=O)c1ccc(Cl)cc1)c1cccs1 |
| InChI | InChI=1S/C18H19ClN2O4S/c1-12(15-3-2-10-26-15)21-16(22)11-25-17(23)8-9-20-18(24)13-4-6-14(19)7-5-13/h2-7,10,12H,8-9,11H2,1H3,(H,20,24)(H,21,22)/t12-/m1/s1 |
| InChIKey | QDWSWSDATJIZCR-GFCCVEGCSA-N |
| XLogP | 2.94 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.88 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |